C14H10BrNO5 — CID 135000333
ethyl 9a-bromo-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate (PubChem CID 135000333) has the molecular formula C14H10BrNO5 and a molecular weight of 352.14 g/mol. Its IUPAC name is ethyl 9a-bromo-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate.
| Compound Name | ethyl 9a-bromo-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 135000333 |
| Molecular Formula | C14H10BrNO5 |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | ethyl 9a-bromo-4,9-dioxo-3aH-benzo[f][1,2]benzoxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC2(Br)C(=O)c3ccccc3C(=O)C12 |
| InChI | InChI=1S/C14H10BrNO5/c1-2-20-13(19)10-9-11(17)7-5-3-4-6-8(7)12(18)14(9,15)21-16-10/h3-6,9H,2H2,1H3 |
| InChIKey | NAMNJSGKSKKDOQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|