C11H9NO3 — CID 123479688
2-imino-3-methoxynaphthalene-1,4-dione (PubChem CID 123479688) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 2-imino-3-methoxynaphthalene-1,4-dione.
| Compound Name | 2-imino-3-methoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 123479688 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-imino-3-methoxynaphthalene-1,4-dione |
| SMILES | [H]/N=C1\C(=O)c2ccccc2C(=O)C1OC |
| InChI | InChI=1S/C11H9NO3/c1-15-11-8(12)9(13)6-4-2-3-5-7(6)10(11)14/h2-5,11-12H,1H3/b12-8+ |
| InChIKey | XDWMSSLGUWISKX-XYOKQWHBSA-N |
| XLogP | 1.10 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|