C11H8O4 — CID 7074658
(3R)-3-methoxynaphthalene-1,2,4-trione (PubChem CID 7074658) has the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. Its IUPAC name is (3R)-3-methoxynaphthalene-1,2,4-trione.
| Compound Name | (3R)-3-methoxynaphthalene-1,2,4-trione |
|---|---|
| PubChem CID | 7074658 |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (3R)-3-methoxynaphthalene-1,2,4-trione |
| SMILES | CO[C@H]1C(=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8O4/c1-15-11-9(13)7-5-3-2-4-6(7)8(12)10(11)14/h2-5,11H,1H3/t11-/m1/s1 |
| InChIKey | IJNKQCOGLCDYDV-LLVKDONJSA-N |
| XLogP | 0.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|