C27H19Cl2NO3 — CID 15442608
6,7a-dibenzyl-3-(2,6-dichlorophenyl)-3aH-1,2-benzoxazole-4,7-dione (PubChem CID 15442608) has the molecular formula C27H19Cl2NO3 and a molecular weight of 476.36 g/mol. Its IUPAC name is 6,7a-dibenzyl-3-(2,6-dichlorophenyl)-3aH-1,2-benzoxazole-4,7-dione.
| Compound Name | 6,7a-dibenzyl-3-(2,6-dichlorophenyl)-3aH-1,2-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 15442608 |
| Molecular Formula | C27H19Cl2NO3 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 6,7a-dibenzyl-3-(2,6-dichlorophenyl)-3aH-1,2-benzoxazole-4,7-dione |
| SMILES | O=C1C=C(Cc2ccccc2)C(=O)C2(Cc3ccccc3)ON=C(c3c(Cl)cccc3Cl)C12 |
| InChI | InChI=1S/C27H19Cl2NO3/c28-20-12-7-13-21(29)23(20)25-24-22(31)15-19(14-17-8-3-1-4-9-17)26(32)27(24,33-30-25)16-18-10-5-2-6-11-18/h1-13,15,24H,14,16H2 |
| InChIKey | XHHGSGSMJQYVIZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |