C35H24Cl6N2O3 — CID 139065743
(1S,5S,7R,11R)-1,11-bis(4-chlorophenyl)-2,10-bis(2,6-dichlorophenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.45]pentadeca-2,9-dien-6-one (PubChem CID 139065743) has the molecular formula C35H24Cl6N2O3 and a molecular weight of 733.31 g/mol. Its IUPAC name is (1S,5S,7R,11R)-1,11-bis(4-chlorophenyl)-2,10-bis(2,6-dichlorophenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.45]pentadeca-2,9-dien-6-one.
| Compound Name | (1S,5S,7R,11R)-1,11-bis(4-chlorophenyl)-2,10-bis(2,6-dichlorophenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.45]pentadeca-2,9-dien-6-one |
|---|---|
| PubChem CID | 139065743 |
| Molecular Formula | C35H24Cl6N2O3 |
| Molecular Weight | 733.31 g/mol |
| Exact Mass | 729.99 |
| IUPAC Name | (1S,5S,7R,11R)-1,11-bis(4-chlorophenyl)-2,10-bis(2,6-dichlorophenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.45]pentadeca-2,9-dien-6-one |
| SMILES | O=C1[C@]2(CCCC[C@@]13ON=C(c1c(Cl)cccc1Cl)[C@@H]3c1ccc(Cl)cc1)ON=C(c1c(Cl)cccc1Cl)[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H24Cl6N2O3/c36-21-13-9-19(10-14-21)29-31(27-23(38)5-3-6-24(27)39)42-45-34(29)17-1-2-18-35(33(34)44)30(20-11-15-22(37)16-12-20)32(43-46-35)28-25(40)7-4-8-26(28)41/h3-16,29-30H,1-2,17-18H2/t29-,30+,34-,35+ |
| InChIKey | ADAGSXDILWFTFD-UGACUELHSA-N |
| XLogP | 10.96 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.31 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |