C34H22Cl6N2O3 — CID 139065689
(1R,5R,7R,11R)-1,11-bis(4-chlorophenyl)-2,10-bis(2,6-dichlorophenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one (PubChem CID 139065689) has the molecular formula C34H22Cl6N2O3 and a molecular weight of 719.28 g/mol. Its IUPAC name is (1R,5R,7R,11R)-1,11-bis(4-chlorophenyl)-2,10-bis(2,6-dichlorophenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one.
| Compound Name | (1R,5R,7R,11R)-1,11-bis(4-chlorophenyl)-2,10-bis(2,6-dichlorophenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one |
|---|---|
| PubChem CID | 139065689 |
| Molecular Formula | C34H22Cl6N2O3 |
| Molecular Weight | 719.28 g/mol |
| Exact Mass | 715.98 |
| IUPAC Name | (1R,5R,7R,11R)-1,11-bis(4-chlorophenyl)-2,10-bis(2,6-dichlorophenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one |
| SMILES | O=C1[C@]2(CCC[C@]13ON=C(c1c(Cl)cccc1Cl)[C@H]3c1ccc(Cl)cc1)ON=C(c1c(Cl)cccc1Cl)[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H22Cl6N2O3/c35-20-12-8-18(9-13-20)28-30(26-22(37)4-1-5-23(26)38)41-44-33(28)16-3-17-34(32(33)43)29(19-10-14-21(36)15-11-19)31(42-45-34)27-24(39)6-2-7-25(27)40/h1-2,4-15,28-29H,3,16-17H2/t28-,29-,33-,34-/m1/s1 |
| InChIKey | NNRONWWUFGWOAS-KANWNJQCSA-N |
| XLogP | 10.57 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.28 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |