C34H24Cl4N2O3 — CID 139065942
(1R,5R,7R,11R)-2,10-bis(2,6-dichlorophenyl)-1,11-diphenyl-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one (PubChem CID 139065942) has the molecular formula C34H24Cl4N2O3 and a molecular weight of 650.39 g/mol. Its IUPAC name is (1R,5R,7R,11R)-2,10-bis(2,6-dichlorophenyl)-1,11-diphenyl-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one.
| Compound Name | (1R,5R,7R,11R)-2,10-bis(2,6-dichlorophenyl)-1,11-diphenyl-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one |
|---|---|
| PubChem CID | 139065942 |
| Molecular Formula | C34H24Cl4N2O3 |
| Molecular Weight | 650.39 g/mol |
| Exact Mass | 648.05 |
| IUPAC Name | (1R,5R,7R,11R)-2,10-bis(2,6-dichlorophenyl)-1,11-diphenyl-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one |
| SMILES | O=C1[C@]2(CCC[C@]13ON=C(c1c(Cl)cccc1Cl)[C@H]3c1ccccc1)ON=C(c1c(Cl)cccc1Cl)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C34H24Cl4N2O3/c35-22-14-7-15-23(36)26(22)30-28(20-10-3-1-4-11-20)33(42-39-30)18-9-19-34(32(33)41)29(21-12-5-2-6-13-21)31(40-43-34)27-24(37)16-8-17-25(27)38/h1-8,10-17,28-29H,9,18-19H2/t28-,29-,33-,34-/m1/s1 |
| InChIKey | QBTUQSVYJPMPIN-KANWNJQCSA-N |
| XLogP | 9.27 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.39 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |