C22H24N2O4 — CID 154430433
(2R,4S)-4-[(4-amino-2-oxobut-3-enoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoic acid (PubChem CID 154430433) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2R,4S)-4-[(4-amino-2-oxobut-3-enoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoic acid.
| Compound Name | (2R,4S)-4-[(4-amino-2-oxobut-3-enoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 154430433 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2R,4S)-4-[(4-amino-2-oxobut-3-enoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoic acid |
| SMILES | C[C@H](C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)C(=O)C=CN)C(=O)O |
| InChI | InChI=1S/C22H24N2O4/c1-15(22(27)28)13-19(24-21(26)20(25)11-12-23)14-16-7-9-18(10-8-16)17-5-3-2-4-6-17/h2-12,15,19H,13-14,23H2,1H3,(H,24,26)(H,27,28)/t15-,19+/m1/s1 |
| InChIKey | AYZWGESJGMHRCK-BEFAXECRSA-N |
| XLogP | 2.53 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|