C14H21N3O2S — CID 154436586
[4-[(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)sulfonyl]phenyl]methanamine (PubChem CID 154436586) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is [4-[(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)sulfonyl]phenyl]methanamine.
| Compound Name | [4-[(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)sulfonyl]phenyl]methanamine |
|---|---|
| PubChem CID | 154436586 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [4-[(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)sulfonyl]phenyl]methanamine |
| SMILES | CN1CCC2CN(S(=O)(=O)c3ccc(CN)cc3)CC21 |
| InChI | InChI=1S/C14H21N3O2S/c1-16-7-6-12-9-17(10-14(12)16)20(18,19)13-4-2-11(8-15)3-5-13/h2-5,12,14H,6-10,15H2,1H3 |
| InChIKey | VZSCMPUVWWPFPN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |