C7H17N2O4P — CID 154438298
2-(tert-butylamino)ethylcarbamoylphosphonic acid (PubChem CID 154438298) has the molecular formula C7H17N2O4P and a molecular weight of 224.20 g/mol. Its IUPAC name is 2-(tert-butylamino)ethylcarbamoylphosphonic acid.
| Compound Name | 2-(tert-butylamino)ethylcarbamoylphosphonic acid |
|---|---|
| PubChem CID | 154438298 |
| Molecular Formula | C7H17N2O4P |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-(tert-butylamino)ethylcarbamoylphosphonic acid |
| SMILES | CC(C)(C)NCCNC(=O)P(=O)(O)O |
| InChI | InChI=1S/C7H17N2O4P/c1-7(2,3)9-5-4-8-6(10)14(11,12)13/h9H,4-5H2,1-3H3,(H,8,10)(H2,11,12,13) |
| InChIKey | HQBRLGQEDHLHLU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|