C12H29IN4O — CID 111759102
1-[2-(tert-butylamino)ethyl]-3-(3-methoxypropyl)-2-methylguanidine;hydroiodide (PubChem CID 111759102) has the molecular formula C12H29IN4O and a molecular weight of 372.30 g/mol. Its IUPAC name is 1-[2-(tert-butylamino)ethyl]-3-(3-methoxypropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(tert-butylamino)ethyl]-3-(3-methoxypropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111759102 |
| Molecular Formula | C12H29IN4O |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[2-(tert-butylamino)ethyl]-3-(3-methoxypropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOC)NCCNC(C)(C)C.I |
| InChI | InChI=1S/C12H28N4O.HI/c1-12(2,3)16-9-8-15-11(13-4)14-7-6-10-17-5;/h16H,6-10H2,1-5H3,(H2,13,14,15);1H |
| InChIKey | RUTBVAFZJBWMHG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 57.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|