C36H43N3O12 — CID 154442552
propan-2-yl (3S)-5-[1-acetyl-3-oxo-2-propan-2-yl-5-(3,4,5-triacetyloxyphenyl)-2H-pyrazin-4-yl]-2-amino-3-benzyl-2-hydroxy-4-oxopentanoate (PubChem CID 154442552) has the molecular formula C36H43N3O12 and a molecular weight of 709.75 g/mol. Its IUPAC name is propan-2-yl (3S)-5-[1-acetyl-3-oxo-2-propan-2-yl-5-(3,4,5-triacetyloxyphenyl)-2H-pyrazin-4-yl]-2-amino-3-benzyl-2-hydroxy-4-oxopentanoate.
| Compound Name | propan-2-yl (3S)-5-[1-acetyl-3-oxo-2-propan-2-yl-5-(3,4,5-triacetyloxyphenyl)-2H-pyrazin-4-yl]-2-amino-3-benzyl-2-hydroxy-4-oxopentanoate |
|---|---|
| PubChem CID | 154442552 |
| Molecular Formula | C36H43N3O12 |
| Molecular Weight | 709.75 g/mol |
| Exact Mass | 709.28 |
| IUPAC Name | propan-2-yl (3S)-5-[1-acetyl-3-oxo-2-propan-2-yl-5-(3,4,5-triacetyloxyphenyl)-2H-pyrazin-4-yl]-2-amino-3-benzyl-2-hydroxy-4-oxopentanoate |
| SMILES | CC(=O)Oc1cc(C2=CN(C(C)=O)C(C(C)C)C(=O)N2CC(=O)[C@@H](Cc2ccccc2)C(N)(O)C(=O)OC(C)C)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C36H43N3O12/c1-19(2)32-34(45)39(18-29(44)27(14-25-12-10-9-11-13-25)36(37,47)35(46)48-20(3)4)28(17-38(32)21(5)40)26-15-30(49-22(6)41)33(51-24(8)43)31(16-26)50-23(7)42/h9-13,15-17,19-20,27,32,47H,14,18,37H2,1-8H3/t27-,32?,36?/m1/s1 |
| InChIKey | DIAUZVHSTHXMSA-GYMSQBMPSA-N |
| XLogP | 2.50 |
| TPSA | 209.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.75 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|