C32H42F3N3O5Si — CID 173224243
1-acetyl-4-(4-amino-3-benzyl-5,5,5-trifluoro-4-hydroxy-2-oxopentyl)-2-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-5-phenyl-2H-pyrazin-3-one (PubChem CID 173224243) has the molecular formula C32H42F3N3O5Si and a molecular weight of 633.78 g/mol. Its IUPAC name is 1-acetyl-4-(4-amino-3-benzyl-5,5,5-trifluoro-4-hydroxy-2-oxopentyl)-2-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-5-phenyl-2H-pyrazin-3-one.
| Compound Name | 1-acetyl-4-(4-amino-3-benzyl-5,5,5-trifluoro-4-hydroxy-2-oxopentyl)-2-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-5-phenyl-2H-pyrazin-3-one |
|---|---|
| PubChem CID | 173224243 |
| Molecular Formula | C32H42F3N3O5Si |
| Molecular Weight | 633.78 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | 1-acetyl-4-(4-amino-3-benzyl-5,5,5-trifluoro-4-hydroxy-2-oxopentyl)-2-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-5-phenyl-2H-pyrazin-3-one |
| SMILES | CC(=O)N1C=C(c2ccccc2)N(CC(=O)C(Cc2ccccc2)C(N)(O)C(F)(F)F)C(=O)C1C(CO[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C32H42F3N3O5Si/c1-21(39)37-18-26(23-15-11-8-12-16-23)38(29(41)28(37)25(30(2,3)4)20-43-44(5)6)19-27(40)24(31(36,42)32(33,34)35)17-22-13-9-7-10-14-22/h7-16,18,24-25,28,42,44H,17,19-20,36H2,1-6H3 |
| InChIKey | USEWOHWWKFFAFJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|