C7H10AlF2N — CID 154443310
1-alumanyl-4,4-difluorocyclohexane-1-carbonitrile (PubChem CID 154443310) has the molecular formula C7H10AlF2N and a molecular weight of 173.14 g/mol. Its IUPAC name is 1-alumanyl-4,4-difluorocyclohexane-1-carbonitrile.
| Compound Name | 1-alumanyl-4,4-difluorocyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 154443310 |
| Molecular Formula | C7H10AlF2N |
| Molecular Weight | 173.14 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 1-alumanyl-4,4-difluorocyclohexane-1-carbonitrile |
| SMILES | N#CC1([AlH2])CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H8F2N.Al.2H/c8-7(9)3-1-6(5-10)2-4-7;;;/h1-4H2;;; |
| InChIKey | JWEVHIPYXHFWBH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |