C10H9F7O4 — CID 154448847
2,2,3,3,5,5,8-heptafluoro-7,7-dimethyl-4,6-dioxooctanoic acid (PubChem CID 154448847) has the molecular formula C10H9F7O4 and a molecular weight of 326.16 g/mol. Its IUPAC name is 2,2,3,3,5,5,8-heptafluoro-7,7-dimethyl-4,6-dioxooctanoic acid.
| Compound Name | 2,2,3,3,5,5,8-heptafluoro-7,7-dimethyl-4,6-dioxooctanoic acid |
|---|---|
| PubChem CID | 154448847 |
| Molecular Formula | C10H9F7O4 |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2,2,3,3,5,5,8-heptafluoro-7,7-dimethyl-4,6-dioxooctanoic acid |
| SMILES | CC(C)(CF)C(=O)C(F)(F)C(=O)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C10H9F7O4/c1-7(2,3-11)4(18)8(12,13)5(19)9(14,15)10(16,17)6(20)21/h3H2,1-2H3,(H,20,21) |
| InChIKey | JYVOZSJHMXKXBW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|