C24H30N2O2S — CID 154449474
[2-amino-3-(1-hexylpiperidin-4-yl)-1-benzothiophen-5-yl]-(furan-2-yl)methanone (PubChem CID 154449474) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is [2-amino-3-(1-hexylpiperidin-4-yl)-1-benzothiophen-5-yl]-(furan-2-yl)methanone.
| Compound Name | [2-amino-3-(1-hexylpiperidin-4-yl)-1-benzothiophen-5-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 154449474 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [2-amino-3-(1-hexylpiperidin-4-yl)-1-benzothiophen-5-yl]-(furan-2-yl)methanone |
| SMILES | CCCCCCN1CCC(c2c(N)sc3ccc(C(=O)c4ccco4)cc23)CC1 |
| InChI | InChI=1S/C24H30N2O2S/c1-2-3-4-5-12-26-13-10-17(11-14-26)22-19-16-18(8-9-21(19)29-24(22)25)23(27)20-7-6-15-28-20/h6-9,15-17H,2-5,10-14,25H2,1H3 |
| InChIKey | XZSDLAUGQWCMHQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|