C24H33N3O4 — CID 154449517
propyl 9-(cyclopentylmethyl)-5-(hydrazinecarbonyl)-8-methoxy-5,6,7,8-tetrahydrocarbazole-4-carboxylate (PubChem CID 154449517) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is propyl 9-(cyclopentylmethyl)-5-(hydrazinecarbonyl)-8-methoxy-5,6,7,8-tetrahydrocarbazole-4-carboxylate.
| Compound Name | propyl 9-(cyclopentylmethyl)-5-(hydrazinecarbonyl)-8-methoxy-5,6,7,8-tetrahydrocarbazole-4-carboxylate |
|---|---|
| PubChem CID | 154449517 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | propyl 9-(cyclopentylmethyl)-5-(hydrazinecarbonyl)-8-methoxy-5,6,7,8-tetrahydrocarbazole-4-carboxylate |
| SMILES | CCCOC(=O)c1cccc2c1c1c(n2CC2CCCC2)C(OC)CCC1C(=O)NN |
| InChI | InChI=1S/C24H33N3O4/c1-3-13-31-24(29)17-9-6-10-18-20(17)21-16(23(28)26-25)11-12-19(30-2)22(21)27(18)14-15-7-4-5-8-15/h6,9-10,15-16,19H,3-5,7-8,11-14,25H2,1-2H3,(H,26,28) |
| InChIKey | NLCHSJWOXJWOKB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|