C16H24F6O4 — CID 154451126
(2R,3R)-7,7,7-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)heptanoic acid (PubChem CID 154451126) has the molecular formula C16H24F6O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is (2R,3R)-7,7,7-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)heptanoic acid.
| Compound Name | (2R,3R)-7,7,7-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)heptanoic acid |
|---|---|
| PubChem CID | 154451126 |
| Molecular Formula | C16H24F6O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (2R,3R)-7,7,7-trifluoro-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)heptanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCC(F)(F)F)[C@@H](CCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H24F6O4/c1-14(2,3)26-13(25)11(7-5-9-16(20,21)22)10(12(23)24)6-4-8-15(17,18)19/h10-11H,4-9H2,1-3H3,(H,23,24)/t10-,11-/m1/s1 |
| InChIKey | FIKJPTOLANVTEM-GHMZBOCLSA-N |
| XLogP | 5.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |