C17H15Cl2NO2 — CID 154452856
1-(2,6-dichlorophenyl)-7-methoxy-3-methyl-3,4-dihydroquinolin-2-one (PubChem CID 154452856) has the molecular formula C17H15Cl2NO2 and a molecular weight of 336.22 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-7-methoxy-3-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 1-(2,6-dichlorophenyl)-7-methoxy-3-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 154452856 |
| Molecular Formula | C17H15Cl2NO2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-7-methoxy-3-methyl-3,4-dihydroquinolin-2-one |
| SMILES | COc1ccc2c(c1)N(c1c(Cl)cccc1Cl)C(=O)C(C)C2 |
| InChI | InChI=1S/C17H15Cl2NO2/c1-10-8-11-6-7-12(22-2)9-15(11)20(17(10)21)16-13(18)4-3-5-14(16)19/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | IXAFEUADGBYGMC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |