C10H6FNO2 — CID 154453029
3-(4-fluoroanilino)cyclobut-3-ene-1,2-dione (PubChem CID 154453029) has the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. Its IUPAC name is 3-(4-fluoroanilino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-fluoroanilino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 154453029 |
| Molecular Formula | C10H6FNO2 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 3-(4-fluoroanilino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1cc(Nc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C10H6FNO2/c11-6-1-3-7(4-2-6)12-8-5-9(13)10(8)14/h1-5,12H |
| InChIKey | MKMDIVUQZSVECH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|