C16H13F3O3 — CID 154453908
2-(methoxymethyl)-6-[4-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 154453908) has the molecular formula C16H13F3O3 and a molecular weight of 310.27 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-[4-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 2-(methoxymethyl)-6-[4-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 154453908 |
| Molecular Formula | C16H13F3O3 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(methoxymethyl)-6-[4-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | COCc1cccc(-c2ccc(C(F)(F)F)cc2)c1C(=O)O |
| InChI | InChI=1S/C16H13F3O3/c1-22-9-11-3-2-4-13(14(11)15(20)21)10-5-7-12(8-6-10)16(17,18)19/h2-8H,9H2,1H3,(H,20,21) |
| InChIKey | VGMDNOMMNKMKEP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |