C20H22F3NO2 — CID 68627660
ethyl 2-[2-(ethylaminomethyl)-3-[4-(trifluoromethyl)phenyl]phenyl]acetate (PubChem CID 68627660) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is ethyl 2-[2-(ethylaminomethyl)-3-[4-(trifluoromethyl)phenyl]phenyl]acetate.
| Compound Name | ethyl 2-[2-(ethylaminomethyl)-3-[4-(trifluoromethyl)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 68627660 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | ethyl 2-[2-(ethylaminomethyl)-3-[4-(trifluoromethyl)phenyl]phenyl]acetate |
| SMILES | CCNCc1c(CC(=O)OCC)cccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3NO2/c1-3-24-13-18-15(12-19(25)26-4-2)6-5-7-17(18)14-8-10-16(11-9-14)20(21,22)23/h5-11,24H,3-4,12-13H2,1-2H3 |
| InChIKey | IBXMGCTYUJYCNK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |