C27H28F3IN2O4 — CID 69338991
ethyl 2-(4-amino-3-iodophenyl)acetate;ethyl 2-[4-amino-3-[4-(trifluoromethyl)phenyl]phenyl]acetate (PubChem CID 69338991) has the molecular formula C27H28F3IN2O4 and a molecular weight of 628.43 g/mol. Its IUPAC name is ethyl 2-(4-amino-3-iodophenyl)acetate;ethyl 2-[4-amino-3-[4-(trifluoromethyl)phenyl]phenyl]acetate.
| Compound Name | ethyl 2-(4-amino-3-iodophenyl)acetate;ethyl 2-[4-amino-3-[4-(trifluoromethyl)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 69338991 |
| Molecular Formula | C27H28F3IN2O4 |
| Molecular Weight | 628.43 g/mol |
| Exact Mass | 628.10 |
| IUPAC Name | ethyl 2-(4-amino-3-iodophenyl)acetate;ethyl 2-[4-amino-3-[4-(trifluoromethyl)phenyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N)c(-c2ccc(C(F)(F)F)cc2)c1.CCOC(=O)Cc1ccc(N)c(I)c1 |
| InChI | InChI=1S/C17H16F3NO2.C10H12INO2/c1-2-23-16(22)10-11-3-8-15(21)14(9-11)12-4-6-13(7-5-12)17(18,19)20;1-2-14-10(13)6-7-3-4-9(12)8(11)5-7/h3-9H,2,10,21H2,1H3;3-5H,2,6,12H2,1H3 |
| InChIKey | OBIBRJPDDNSEHJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|