C17H19FN2O4 — CID 154456967
4-(1-cyano-2-ethoxy-2-oxoethyl)-4-(4-fluorophenyl)piperidine-1-carboxylic acid (PubChem CID 154456967) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is 4-(1-cyano-2-ethoxy-2-oxoethyl)-4-(4-fluorophenyl)piperidine-1-carboxylic acid.
| Compound Name | 4-(1-cyano-2-ethoxy-2-oxoethyl)-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154456967 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 4-(1-cyano-2-ethoxy-2-oxoethyl)-4-(4-fluorophenyl)piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)C(C#N)C1(c2ccc(F)cc2)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C17H19FN2O4/c1-2-24-15(21)14(11-19)17(12-3-5-13(18)6-4-12)7-9-20(10-8-17)16(22)23/h3-6,14H,2,7-10H2,1H3,(H,22,23) |
| InChIKey | JNHVPSQLOIWFJV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |