About 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one
6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one (PubChem CID 154460624) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one.
Analyze 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one?
The IUPAC name of 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one (CID 154460624) is 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one.
What is the SMILES notation for 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one?
The canonical SMILES for 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one is O=c1ccnc2n1CCOCC2.
What is the InChIKey of 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one?
The InChIKey is JWWZWIJAIASOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c11-8-1-3-9-7-2-5-12-6-4-10(7)8/h1,3H,2,4-6H2.
What are the key properties of 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one?
6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one has a molecular weight of 166.18 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-4-one is sourced from PubChem (CID 154460624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).