C12H12F3N3O — CID 154464772
(1S,4S)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carbaldehyde (PubChem CID 154464772) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is (1S,4S)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carbaldehyde.
| Compound Name | (1S,4S)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carbaldehyde |
|---|---|
| PubChem CID | 154464772 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (1S,4S)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carbaldehyde |
| SMILES | O=CN1C[C@@H]2C[C@H]1CN2c1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C12H12F3N3O/c13-12(14,15)8-1-2-16-11(3-8)18-6-9-4-10(18)5-17(9)7-19/h1-3,7,9-10H,4-6H2/t9-,10-/m0/s1 |
| InChIKey | LSTJODXIQAJBCE-UWVGGRQHSA-N |
| XLogP | 1.52 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|