C11H12ClF3N2 — CID 66329106
2-[2-(chloromethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyridine (PubChem CID 66329106) has the molecular formula C11H12ClF3N2 and a molecular weight of 264.68 g/mol. Its IUPAC name is 2-[2-(chloromethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyridine.
| Compound Name | 2-[2-(chloromethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 66329106 |
| Molecular Formula | C11H12ClF3N2 |
| Molecular Weight | 264.68 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-[2-(chloromethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccnc(N2CCCC2CCl)c1 |
| InChI | InChI=1S/C11H12ClF3N2/c12-7-9-2-1-5-17(9)10-6-8(3-4-16-10)11(13,14)15/h3-4,6,9H,1-2,5,7H2 |
| InChIKey | SZDBBQHRTHZAIG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|