C14H16ClF4N — CID 107304083
2-(3-chloropropyl)-1-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 107304083) has the molecular formula C14H16ClF4N and a molecular weight of 309.73 g/mol. Its IUPAC name is 2-(3-chloropropyl)-1-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | 2-(3-chloropropyl)-1-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 107304083 |
| Molecular Formula | C14H16ClF4N |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-(3-chloropropyl)-1-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | Fc1cc(C(F)(F)F)ccc1N1CCCC1CCCCl |
| InChI | InChI=1S/C14H16ClF4N/c15-7-1-3-11-4-2-8-20(11)13-6-5-10(9-12(13)16)14(17,18)19/h5-6,9,11H,1-4,7-8H2 |
| InChIKey | QSLYDUCOYGLIRB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|