C14H20ClNO2S — CID 55182800
2-(3-chloropropyl)-1-(2-methylsulfonylphenyl)pyrrolidine (PubChem CID 55182800) has the molecular formula C14H20ClNO2S and a molecular weight of 301.84 g/mol. Its IUPAC name is 2-(3-chloropropyl)-1-(2-methylsulfonylphenyl)pyrrolidine.
| Compound Name | 2-(3-chloropropyl)-1-(2-methylsulfonylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 55182800 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(3-chloropropyl)-1-(2-methylsulfonylphenyl)pyrrolidine |
| SMILES | CS(=O)(=O)c1ccccc1N1CCCC1CCCCl |
| InChI | InChI=1S/C14H20ClNO2S/c1-19(17,18)14-9-3-2-8-13(14)16-11-5-7-12(16)6-4-10-15/h2-3,8-9,12H,4-7,10-11H2,1H3 |
| InChIKey | PXELZIXCRNOAEY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|