C12H17N3O2 — CID 154469851
1-[(Z)-5-(methylideneamino)-3-methyliminopent-4-enyl]piperidine-2,6-dione (PubChem CID 154469851) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-[(Z)-5-(methylideneamino)-3-methyliminopent-4-enyl]piperidine-2,6-dione.
| Compound Name | 1-[(Z)-5-(methylideneamino)-3-methyliminopent-4-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154469851 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-[(Z)-5-(methylideneamino)-3-methyliminopent-4-enyl]piperidine-2,6-dione |
| SMILES | C=N/C=C\C(CCN1C(=O)CCCC1=O)=N/C |
| InChI | InChI=1S/C12H17N3O2/c1-13-8-6-10(14-2)7-9-15-11(16)4-3-5-12(15)17/h6,8H,1,3-5,7,9H2,2H3/b8-6-,14-10+ |
| InChIKey | RQUGDZLTSQTFMO-QRYCYNQSSA-N |
| XLogP | 1.20 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|