C12H22N2O — CID 91507600
N,N-diethyl-3,4-dihydropyridine-2-carboxamide;ethane (PubChem CID 91507600) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N,N-diethyl-3,4-dihydropyridine-2-carboxamide;ethane.
| Compound Name | N,N-diethyl-3,4-dihydropyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 91507600 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N,N-diethyl-3,4-dihydropyridine-2-carboxamide;ethane |
| SMILES | CC.CCN(CC)C(=O)C1=NC=CCC1 |
| InChI | InChI=1S/C10H16N2O.C2H6/c1-3-12(4-2)10(13)9-7-5-6-8-11-9;1-2/h6,8H,3-5,7H2,1-2H3;1-2H3 |
| InChIKey | GCVKEIZDXZLFDX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |