C8H9AlN2O — CID 154471633
(3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol (PubChem CID 154471633) has the molecular formula C8H9AlN2O and a molecular weight of 176.16 g/mol. Its IUPAC name is (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol.
| Compound Name | (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol |
|---|---|
| PubChem CID | 154471633 |
| Molecular Formula | C8H9AlN2O |
| Molecular Weight | 176.16 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol |
| SMILES | OCc1ccn2c([AlH2])cnc2c1 |
| InChI | InChI=1S/C8H7N2O.Al.2H/c11-6-7-1-3-10-4-2-9-8(10)5-7;;;/h1-3,5,11H,6H2;;; |
| InChIKey | XOUOLXBXHIJAMT-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |