About (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol
(3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol (PubChem CID 154471633) has the molecular formula C8H9AlN2O
and a molecular weight of 176.16 g/mol. Its IUPAC name is (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol.
Molecular Properties
| Compound Name | (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol |
| PubChem CID | 154471633 |
| Molecular Formula | C8H9AlN2O |
| Molecular Weight | 176.16 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol |
| SMILES | OCc1ccn2c([AlH2])cnc2c1 |
| InChI | InChI=1S/C8H7N2O.Al.2H/c11-6-7-1-3-10-4-2-9-8(10)5-7;;;/h1-3,5,11H,6H2;;; |
| InChIKey | XOUOLXBXHIJAMT-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol?
The IUPAC name of (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol (CID 154471633) is (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol.
What is the SMILES notation for (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol?
The canonical SMILES for (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol is OCc1ccn2c([AlH2])cnc2c1.
What is the InChIKey of (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol?
The InChIKey is XOUOLXBXHIJAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2O.Al.2H/c11-6-7-1-3-10-4-2-9-8(10)5-7;;;/h1-3,5,11H,6H2;;;.
What are the key properties of (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol?
(3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol has a molecular weight of 176.16 g/mol, XLogP of -0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-alumanylimidazo[1,2-a]pyridin-7-yl)methanol is sourced from PubChem (CID 154471633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).