About (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol
(2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol (PubChem CID 129019467) has the molecular formula C7H6BrN3O
and a molecular weight of 228.05 g/mol. Its IUPAC name is (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol.
Analyze (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol?
The IUPAC name of (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol (CID 129019467) is (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol.
What is the SMILES notation for (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol?
The canonical SMILES for (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol is OCc1ccn2nc(Br)nc2c1.
What is the InChIKey of (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol?
The InChIKey is KUVQOTWOCLFWGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3O/c8-7-9-6-3-5(4-12)1-2-11(6)10-7/h1-3,12H,4H2.
What are the key properties of (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol?
(2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol has a molecular weight of 228.05 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanol is sourced from PubChem (CID 129019467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).