C11H16N4 — CID 68574948
7-pentyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 68574948) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 7-pentyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 7-pentyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 68574948 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 7-pentyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CCCCCc1ccn2nc(N)nc2c1 |
| InChI | InChI=1S/C11H16N4/c1-2-3-4-5-9-6-7-15-10(8-9)13-11(12)14-15/h6-8H,2-5H2,1H3,(H2,12,14) |
| InChIKey | MDNPBUFWUMRJRV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|