C32H30F2N8OS — CID 154473003
2-[[5-[4-amino-3-(N'-ethylcarbamimidoyl)phenyl]thiophen-2-yl]methylamino]-N,N-bis[(5-fluoro-3-pyridinyl)methyl]pyridine-3-carboxamide (PubChem CID 154473003) has the molecular formula C32H30F2N8OS and a molecular weight of 612.71 g/mol. Its IUPAC name is 2-[[5-[4-amino-3-(N'-ethylcarbamimidoyl)phenyl]thiophen-2-yl]methylamino]-N,N-bis[(5-fluoro-3-pyridinyl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-[[5-[4-amino-3-(N'-ethylcarbamimidoyl)phenyl]thiophen-2-yl]methylamino]-N,N-bis[(5-fluoro-3-pyridinyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154473003 |
| Molecular Formula | C32H30F2N8OS |
| Molecular Weight | 612.71 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | 2-[[5-[4-amino-3-(N'-ethylcarbamimidoyl)phenyl]thiophen-2-yl]methylamino]-N,N-bis[(5-fluoro-3-pyridinyl)methyl]pyridine-3-carboxamide |
| SMILES | CC/N=C(\N)c1cc(-c2ccc(CNc3ncccc3C(=O)N(Cc3cncc(F)c3)Cc3cncc(F)c3)s2)ccc1N |
| InChI | InChI=1S/C32H30F2N8OS/c1-2-39-30(36)27-12-22(5-7-28(27)35)29-8-6-25(44-29)17-41-31-26(4-3-9-40-31)32(43)42(18-20-10-23(33)15-37-13-20)19-21-11-24(34)16-38-14-21/h3-16H,2,17-19,35H2,1H3,(H2,36,39)(H,40,41) |
| InChIKey | SBBNZWLSMCRMNH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|