N-ethenylpropanimidoyl fluoride

C5H8FN — CID 154473419

IUPACN-ethenylpropanimidoyl fluoride
SMILESC=C/N=C(\F)CC
InChIInChI=1S/C5H8FN/c1-3-5(6)7-4-2/h4H,2-3H2,1H3/b7-5-
InChIKeyMXHKIQUPKLRIEX-ALCCZGGFSA-N
MW101.12 g/mol
LogP1.91
Rot. Bonds2

About N-ethenylpropanimidoyl fluoride

N-ethenylpropanimidoyl fluoride (PubChem CID 154473419) has the molecular formula C5H8FN and a molecular weight of 101.12 g/mol. Its IUPAC name is N-ethenylpropanimidoyl fluoride.

Molecular Properties

Compound NameN-ethenylpropanimidoyl fluoride
PubChem CID154473419
Molecular FormulaC5H8FN
Molecular Weight101.12 g/mol
Exact Mass101.06
IUPAC NameN-ethenylpropanimidoyl fluoride
SMILESC=C/N=C(\F)CC
InChIInChI=1S/C5H8FN/c1-3-5(6)7-4-2/h4H,2-3H2,1H3/b7-5-
InChIKeyMXHKIQUPKLRIEX-ALCCZGGFSA-N
XLogP1.91
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500101.12
LogP ≤ 51.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-ethenylpropanimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-ethenylpropanimidoyl fluoride?
The IUPAC name of N-ethenylpropanimidoyl fluoride (CID 154473419) is N-ethenylpropanimidoyl fluoride.
What is the SMILES notation for N-ethenylpropanimidoyl fluoride?
The canonical SMILES for N-ethenylpropanimidoyl fluoride is C=C/N=C(\F)CC.
What is the InChIKey of N-ethenylpropanimidoyl fluoride?
The InChIKey is MXHKIQUPKLRIEX-ALCCZGGFSA-N. The full InChI is InChI=1S/C5H8FN/c1-3-5(6)7-4-2/h4H,2-3H2,1H3/b7-5-.
What are the key properties of N-ethenylpropanimidoyl fluoride?
N-ethenylpropanimidoyl fluoride has a molecular weight of 101.12 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenylpropanimidoyl fluoride is sourced from PubChem (CID 154473419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).