C21H37NO4S — CID 154476249
ethyl (E)-7-[(3-cyclohexyl-3-hydroxypropyl)amino]-8-ethoxy-8-sulfanylideneoct-4-enoate (PubChem CID 154476249) has the molecular formula C21H37NO4S and a molecular weight of 399.60 g/mol. Its IUPAC name is ethyl (E)-7-[(3-cyclohexyl-3-hydroxypropyl)amino]-8-ethoxy-8-sulfanylideneoct-4-enoate.
| Compound Name | ethyl (E)-7-[(3-cyclohexyl-3-hydroxypropyl)amino]-8-ethoxy-8-sulfanylideneoct-4-enoate |
|---|---|
| PubChem CID | 154476249 |
| Molecular Formula | C21H37NO4S |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | ethyl (E)-7-[(3-cyclohexyl-3-hydroxypropyl)amino]-8-ethoxy-8-sulfanylideneoct-4-enoate |
| SMILES | CCOC(=O)CC/C=C/CC(NCCC(O)C1CCCCC1)C(=S)OCC |
| InChI | InChI=1S/C21H37NO4S/c1-3-25-20(24)14-10-6-9-13-18(21(27)26-4-2)22-16-15-19(23)17-11-7-5-8-12-17/h6,9,17-19,22-23H,3-5,7-8,10-16H2,1-2H3/b9-6+ |
| InChIKey | FDRBRIAYFXLQKR-RMKNXTFCSA-N |
| XLogP | 3.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|