C23H43NO5 — CID 54442044
diethyl 2-[(3-hydroxy-3,4-dimethyloctyl)amino]non-4-enedioate (PubChem CID 54442044) has the molecular formula C23H43NO5 and a molecular weight of 413.60 g/mol. Its IUPAC name is diethyl 2-[(3-hydroxy-3,4-dimethyloctyl)amino]non-4-enedioate.
| Compound Name | diethyl 2-[(3-hydroxy-3,4-dimethyloctyl)amino]non-4-enedioate |
|---|---|
| PubChem CID | 54442044 |
| Molecular Formula | C23H43NO5 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | diethyl 2-[(3-hydroxy-3,4-dimethyloctyl)amino]non-4-enedioate |
| SMILES | CCCCC(C)C(C)(O)CCNC(CC=CCCCC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H43NO5/c1-6-9-14-19(4)23(5,27)17-18-24-20(22(26)29-8-3)15-12-10-11-13-16-21(25)28-7-2/h10,12,19-20,24,27H,6-9,11,13-18H2,1-5H3 |
| InChIKey | WOUMGKCRORMYFM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|