C19H20O3S — CID 15448595
(1'R,2'S,5'S,7'R,8'S)-5'-phenylsulfanylspiro[1,3-dioxolane-2,6'-tricyclo[6.2.1.02,7]undec-9-ene]-3'-one (PubChem CID 15448595) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is (1'R,2'S,5'S,7'R,8'S)-5'-phenylsulfanylspiro[1,3-dioxolane-2,6'-tricyclo[6.2.1.02,7]undec-9-ene]-3'-one.
| Compound Name | (1'R,2'S,5'S,7'R,8'S)-5'-phenylsulfanylspiro[1,3-dioxolane-2,6'-tricyclo[6.2.1.02,7]undec-9-ene]-3'-one |
|---|---|
| PubChem CID | 15448595 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (1'R,2'S,5'S,7'R,8'S)-5'-phenylsulfanylspiro[1,3-dioxolane-2,6'-tricyclo[6.2.1.02,7]undec-9-ene]-3'-one |
| SMILES | O=C1C[C@H](Sc2ccccc2)C2(OCCO2)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C19H20O3S/c20-15-11-16(23-14-4-2-1-3-5-14)19(21-8-9-22-19)18-13-7-6-12(10-13)17(15)18/h1-7,12-13,16-18H,8-11H2/t12-,13+,16-,17+,18+/m0/s1 |
| InChIKey | HBPOZZMFPJIWJH-KISNFGTJSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|