C20H24O3S — CID 15448597
(3'S,4'aR,8'aS)-6',7'-dimethyl-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one (PubChem CID 15448597) has the molecular formula C20H24O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is (3'S,4'aR,8'aS)-6',7'-dimethyl-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one.
| Compound Name | (3'S,4'aR,8'aS)-6',7'-dimethyl-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 15448597 |
| Molecular Formula | C20H24O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (3'S,4'aR,8'aS)-6',7'-dimethyl-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one |
| SMILES | CC1=C(C)C[C@@H]2[C@H](C1)C(=O)C[C@H](Sc1ccccc1)C21OCCO1 |
| InChI | InChI=1S/C20H24O3S/c1-13-10-16-17(11-14(13)2)20(22-8-9-23-20)19(12-18(16)21)24-15-6-4-3-5-7-15/h3-7,16-17,19H,8-12H2,1-2H3/t16-,17+,19-/m0/s1 |
| InChIKey | FDQMSUGTAVTGLI-SCTDSRPQSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|