C21H17ClN2O2 — CID 154491155
4-acetyl-3-(4-chlorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one (PubChem CID 154491155) has the molecular formula C21H17ClN2O2 and a molecular weight of 364.83 g/mol. Its IUPAC name is 4-acetyl-3-(4-chlorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one.
| Compound Name | 4-acetyl-3-(4-chlorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 154491155 |
| Molecular Formula | C21H17ClN2O2 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-acetyl-3-(4-chlorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one |
| SMILES | CC(=O)c1c(-c2ccc(Cl)cc2)c(=O)n(C)c2c1c1ccccc1n2C |
| InChI | InChI=1S/C21H17ClN2O2/c1-12(25)17-18(13-8-10-14(22)11-9-13)21(26)24(3)20-19(17)15-6-4-5-7-16(15)23(20)2/h4-11H,1-3H3 |
| InChIKey | OBYKNYKMOCJYAP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |