C26H22ClNO4 — CID 68958008
3-[2-(4-acetylphenoxy)ethoxy]-2-(4-chlorophenyl)-1-methylquinolin-4-one (PubChem CID 68958008) has the molecular formula C26H22ClNO4 and a molecular weight of 447.92 g/mol. Its IUPAC name is 3-[2-(4-acetylphenoxy)ethoxy]-2-(4-chlorophenyl)-1-methylquinolin-4-one.
| Compound Name | 3-[2-(4-acetylphenoxy)ethoxy]-2-(4-chlorophenyl)-1-methylquinolin-4-one |
|---|---|
| PubChem CID | 68958008 |
| Molecular Formula | C26H22ClNO4 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 3-[2-(4-acetylphenoxy)ethoxy]-2-(4-chlorophenyl)-1-methylquinolin-4-one |
| SMILES | CC(=O)c1ccc(OCCOc2c(-c3ccc(Cl)cc3)n(C)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H22ClNO4/c1-17(29)18-9-13-21(14-10-18)31-15-16-32-26-24(19-7-11-20(27)12-8-19)28(2)23-6-4-3-5-22(23)25(26)30/h3-14H,15-16H2,1-2H3 |
| InChIKey | NRLJEULTRCZIRX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|