C26H21F2NO4 — CID 68961982
3-[2-(3-acetylphenoxy)ethoxy]-2-(3,4-difluorophenyl)-1-methylquinolin-4-one (PubChem CID 68961982) has the molecular formula C26H21F2NO4 and a molecular weight of 449.45 g/mol. Its IUPAC name is 3-[2-(3-acetylphenoxy)ethoxy]-2-(3,4-difluorophenyl)-1-methylquinolin-4-one.
| Compound Name | 3-[2-(3-acetylphenoxy)ethoxy]-2-(3,4-difluorophenyl)-1-methylquinolin-4-one |
|---|---|
| PubChem CID | 68961982 |
| Molecular Formula | C26H21F2NO4 |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3-[2-(3-acetylphenoxy)ethoxy]-2-(3,4-difluorophenyl)-1-methylquinolin-4-one |
| SMILES | CC(=O)c1cccc(OCCOc2c(-c3ccc(F)c(F)c3)n(C)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C26H21F2NO4/c1-16(30)17-6-5-7-19(14-17)32-12-13-33-26-24(18-10-11-21(27)22(28)15-18)29(2)23-9-4-3-8-20(23)25(26)31/h3-11,14-15H,12-13H2,1-2H3 |
| InChIKey | NDSALCWSBXXZOS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|