C29H23FN2O5S — CID 11364566
(5E)-5-[1-[4-[2-[2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11364566) has the molecular formula C29H23FN2O5S and a molecular weight of 530.58 g/mol. Its IUPAC name is (5E)-5-[1-[4-[2-[2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[1-[4-[2-[2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11364566 |
| Molecular Formula | C29H23FN2O5S |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | (5E)-5-[1-[4-[2-[2-(4-fluorophenyl)-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C/C(=C1\SC(=O)NC1=O)c1ccc(OCCOc2c(-c3ccc(F)cc3)n(C)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H23FN2O5S/c1-17(27-28(34)31-29(35)38-27)18-9-13-21(14-10-18)36-15-16-37-26-24(19-7-11-20(30)12-8-19)32(2)23-6-4-3-5-22(23)25(26)33/h3-14H,15-16H2,1-2H3,(H,31,34,35)/b27-17+ |
| InChIKey | XSFNSTKKMDWDSK-WPWMEQJKSA-N |
| XLogP | 5.52 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|