C29H23FN2O6S — CID 11307315
(5Z)-5-[1-[4-[2-[6-fluoro-2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxyethylamino]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11307315) has the molecular formula C29H23FN2O6S and a molecular weight of 546.58 g/mol. Its IUPAC name is (5Z)-5-[1-[4-[2-[6-fluoro-2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxyethylamino]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[1-[4-[2-[6-fluoro-2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxyethylamino]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11307315 |
| Molecular Formula | C29H23FN2O6S |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | (5Z)-5-[1-[4-[2-[6-fluoro-2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxyethylamino]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(-c2oc3ccc(F)cc3c(=O)c2OCCNc2ccc(/C(C)=C3\SC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C29H23FN2O6S/c1-16(27-28(34)32-29(35)39-27)17-3-8-20(9-4-17)31-13-14-37-26-24(33)22-15-19(30)7-12-23(22)38-25(26)18-5-10-21(36-2)11-6-18/h3-12,15,31H,13-14H2,1-2H3,(H,32,34,35)/b27-16- |
| InChIKey | RPDQGBUMXKYLIM-YUMHPJSZSA-N |
| XLogP | 5.81 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|