C28H21NO6S2 — CID 11237903
(5Z)-5-[[4-[2-[2-(4-methylsulfanylphenyl)-4-oxochromen-3-yl]oxyethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11237903) has the molecular formula C28H21NO6S2 and a molecular weight of 531.61 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-[2-(4-methylsulfanylphenyl)-4-oxochromen-3-yl]oxyethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-[2-(4-methylsulfanylphenyl)-4-oxochromen-3-yl]oxyethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11237903 |
| Molecular Formula | C28H21NO6S2 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | (5Z)-5-[[4-[2-[2-(4-methylsulfanylphenyl)-4-oxochromen-3-yl]oxyethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CSc1ccc(-c2oc3ccccc3c(=O)c2OCCOc2ccc(/C=C3\SC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C28H21NO6S2/c1-36-20-12-8-18(9-13-20)25-26(24(30)21-4-2-3-5-22(21)35-25)34-15-14-33-19-10-6-17(7-11-19)16-23-27(31)29-28(32)37-23/h2-13,16H,14-15H2,1H3,(H,29,31,32)/b23-16- |
| InChIKey | MLAKESCCBRIXFG-KQWNVCNZSA-N |
| XLogP | 5.96 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|