C24H18N2O4S — CID 54414745
5-[[4-(2-phenoxazin-10-ylethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 54414745) has the molecular formula C24H18N2O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is 5-[[4-(2-phenoxazin-10-ylethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(2-phenoxazin-10-ylethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 54414745 |
| Molecular Formula | C24H18N2O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 5-[[4-(2-phenoxazin-10-ylethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OCCN3c4ccccc4Oc4ccccc43)cc2)S1 |
| InChI | InChI=1S/C24H18N2O4S/c27-23-22(31-24(28)25-23)15-16-9-11-17(12-10-16)29-14-13-26-18-5-1-3-7-20(18)30-21-8-4-2-6-19(21)26/h1-12,15H,13-14H2,(H,25,27,28) |
| InChIKey | VWPRVJFIIHXWEQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|