C26H18N2O4S — CID 11363022
(5Z)-5-[[4-methoxy-3-(3-phenoxazin-10-ylprop-1-ynyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11363022) has the molecular formula C26H18N2O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is (5Z)-5-[[4-methoxy-3-(3-phenoxazin-10-ylprop-1-ynyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-methoxy-3-(3-phenoxazin-10-ylprop-1-ynyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11363022 |
| Molecular Formula | C26H18N2O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | (5Z)-5-[[4-methoxy-3-(3-phenoxazin-10-ylprop-1-ynyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2\SC(=O)NC2=O)cc1C#CCN1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C26H18N2O4S/c1-31-21-13-12-17(16-24-25(29)27-26(30)33-24)15-18(21)7-6-14-28-19-8-2-4-10-22(19)32-23-11-5-3-9-20(23)28/h2-5,8-13,15-16H,14H2,1H3,(H,27,29,30)/b24-16- |
| InChIKey | DBGRKSFMZXQYKB-JLPGSUDCSA-N |
| XLogP | 5.31 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|