C25H20N2O4S2 — CID 54573702
5-[[3-methoxy-4-(2-phenothiazin-10-ylethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 54573702) has the molecular formula C25H20N2O4S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 5-[[3-methoxy-4-(2-phenothiazin-10-ylethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-methoxy-4-(2-phenothiazin-10-ylethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 54573702 |
| Molecular Formula | C25H20N2O4S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 5-[[3-methoxy-4-(2-phenothiazin-10-ylethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)ccc1OCCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C25H20N2O4S2/c1-30-20-14-16(15-23-24(28)26-25(29)33-23)10-11-19(20)31-13-12-27-17-6-2-4-8-21(17)32-22-9-5-3-7-18(22)27/h2-11,14-15H,12-13H2,1H3,(H,26,28,29) |
| InChIKey | ZZCAABYZQNAAHU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|