C23H27N9 — CID 154493112
1-cyano-2-(2-methylpropyl)-3-[3-[1-pyridin-3-yl-5-(2H-tetrazol-5-yl)pent-1-enyl]phenyl]guanidine (PubChem CID 154493112) has the molecular formula C23H27N9 and a molecular weight of 429.53 g/mol. Its IUPAC name is 1-cyano-2-(2-methylpropyl)-3-[3-[1-pyridin-3-yl-5-(2H-tetrazol-5-yl)pent-1-enyl]phenyl]guanidine.
| Compound Name | 1-cyano-2-(2-methylpropyl)-3-[3-[1-pyridin-3-yl-5-(2H-tetrazol-5-yl)pent-1-enyl]phenyl]guanidine |
|---|---|
| PubChem CID | 154493112 |
| Molecular Formula | C23H27N9 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-cyano-2-(2-methylpropyl)-3-[3-[1-pyridin-3-yl-5-(2H-tetrazol-5-yl)pent-1-enyl]phenyl]guanidine |
| SMILES | CC(C)C/N=C(\NC#N)Nc1cccc(C(=CCCCc2nn[nH]n2)c2cccnc2)c1 |
| InChI | InChI=1S/C23H27N9/c1-17(2)14-26-23(27-16-24)28-20-9-5-7-18(13-20)21(19-8-6-12-25-15-19)10-3-4-11-22-29-31-32-30-22/h5-10,12-13,15,17H,3-4,11,14H2,1-2H3,(H2,26,27,28)(H,29,30,31,32) |
| InChIKey | KRWZULQMZRWDDT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|